C13H22O5 — CID 113383105
2-cyclopentyl-4-methoxy-2-methoxycarbonylpentanoic acid (PubChem CID 113383105) has the molecular formula C13H22O5 and a molecular weight of 258.31 g/mol. Its IUPAC name is 2-cyclopentyl-4-methoxy-2-methoxycarbonylpentanoic acid.
| Compound Name | 2-cyclopentyl-4-methoxy-2-methoxycarbonylpentanoic acid |
|---|---|
| PubChem CID | 113383105 |
| Molecular Formula | C13H22O5 |
| Molecular Weight | 258.31 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | 2-cyclopentyl-4-methoxy-2-methoxycarbonylpentanoic acid |
| SMILES | COC(=O)C(CC(C)OC)(C(=O)O)C1CCCC1 |
| InChI | InChI=1S/C13H22O5/c1-9(17-2)8-13(11(14)15,12(16)18-3)10-6-4-5-7-10/h9-10H,4-8H2,1-3H3,(H,14,15) |
| InChIKey | XRCFRZQAGOXSLD-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.31 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|