C12H16N2 — CID 10397607
(1R,2R)-7-methyl-2-pyridin-2-yl-7-azabicyclo[2.2.1]heptane (PubChem CID 10397607) has the molecular formula C12H16N2 and a molecular weight of 188.27 g/mol. Its IUPAC name is (1R,2R)-7-methyl-2-pyridin-2-yl-7-azabicyclo[2.2.1]heptane.
| Compound Name | (1R,2R)-7-methyl-2-pyridin-2-yl-7-azabicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 10397607 |
| Molecular Formula | C12H16N2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | (1R,2R)-7-methyl-2-pyridin-2-yl-7-azabicyclo[2.2.1]heptane |
| SMILES | CN1C2CC[C@@H]1[C@H](c1ccccn1)C2 |
| InChI | InChI=1S/C12H16N2/c1-14-9-5-6-12(14)10(8-9)11-4-2-3-7-13-11/h2-4,7,9-10,12H,5-6,8H2,1H3/t9?,10-,12+/m0/s1 |
| InChIKey | CWJBXOZISOWCAQ-OJBNZGHXSA-N |
| XLogP | 2.03 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |