C14H22N2O2 — CID 103977183
2,4,5-trimethyl-N-(1-pyrrolidin-3-ylethyl)furan-3-carboxamide (PubChem CID 103977183) has the molecular formula C14H22N2O2 and a molecular weight of 250.34 g/mol. Its IUPAC name is 2,4,5-trimethyl-N-(1-pyrrolidin-3-ylethyl)furan-3-carboxamide.
| Compound Name | 2,4,5-trimethyl-N-(1-pyrrolidin-3-ylethyl)furan-3-carboxamide |
|---|---|
| PubChem CID | 103977183 |
| Molecular Formula | C14H22N2O2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | 2,4,5-trimethyl-N-(1-pyrrolidin-3-ylethyl)furan-3-carboxamide |
| SMILES | Cc1oc(C)c(C(=O)NC(C)C2CCNC2)c1C |
| InChI | InChI=1S/C14H22N2O2/c1-8-10(3)18-11(4)13(8)14(17)16-9(2)12-5-6-15-7-12/h9,12,15H,5-7H2,1-4H3,(H,16,17) |
| InChIKey | NXKZIKBHMNWUES-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 54.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |