C14H24N2O4 — CID 103978319
2-[[2-(tert-butylamino)-2-oxoethyl]-methylcarbamoyl]cyclopentane-1-carboxylic acid (PubChem CID 103978319) has the molecular formula C14H24N2O4 and a molecular weight of 284.36 g/mol. Its IUPAC name is 2-[[2-(tert-butylamino)-2-oxoethyl]-methylcarbamoyl]cyclopentane-1-carboxylic acid.
| Compound Name | 2-[[2-(tert-butylamino)-2-oxoethyl]-methylcarbamoyl]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 103978319 |
| Molecular Formula | C14H24N2O4 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.17 |
| IUPAC Name | 2-[[2-(tert-butylamino)-2-oxoethyl]-methylcarbamoyl]cyclopentane-1-carboxylic acid |
| SMILES | CN(CC(=O)NC(C)(C)C)C(=O)C1CCCC1C(=O)O |
| InChI | InChI=1S/C14H24N2O4/c1-14(2,3)15-11(17)8-16(4)12(18)9-6-5-7-10(9)13(19)20/h9-10H,5-8H2,1-4H3,(H,15,17)(H,19,20) |
| InChIKey | JLXVBGRWAGAUCG-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |