C10H16N2O5 — CID 10037452
trans-(1R,2R)-2-[[2-(hydroxyamino)-2-oxoethyl]-methylcarbamoyl]cyclopentane-1-carboxylic acid (PubChem CID 10037452) has the molecular formula C10H16N2O5 and a molecular weight of 244.25 g/mol. Its IUPAC name is trans-(1R,2R)-2-[[2-(hydroxyamino)-2-oxoethyl]-methylcarbamoyl]cyclopentane-1-carboxylic acid.
| Compound Name | trans-(1R,2R)-2-[[2-(hydroxyamino)-2-oxoethyl]-methylcarbamoyl]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 10037452 |
| Molecular Formula | C10H16N2O5 |
| Molecular Weight | 244.25 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | trans-(1R,2R)-2-[[2-(hydroxyamino)-2-oxoethyl]-methylcarbamoyl]cyclopentane-1-carboxylic acid |
| SMILES | CN(CC(=O)NO)C(=O)[C@@H]1CCC[C@H]1C(=O)O |
| InChI | InChI=1S/C10H16N2O5/c1-12(5-8(13)11-17)9(14)6-3-2-4-7(6)10(15)16/h6-7,17H,2-5H2,1H3,(H,11,13)(H,15,16)/t6-,7-/m1/s1 |
| InChIKey | VIPHGPCCWVUWJA-RNFRBKRXSA-N |
| XLogP | -0.55 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.25 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|