About 3-amino-N,2-dimethyl-N-[2-(methylamino)-2-oxoethyl]cyclohexane-1-carboxamide
3-amino-N,2-dimethyl-N-[2-(methylamino)-2-oxoethyl]cyclohexane-1-carboxamide (PubChem CID 62782674) has the molecular formula C12H23N3O2
and a molecular weight of 241.33 g/mol. Its IUPAC name is 3-amino-N,2-dimethyl-N-[2-(methylamino)-2-oxoethyl]cyclohexane-1-carboxamide.
Molecular Properties
| Compound Name | 3-amino-N,2-dimethyl-N-[2-(methylamino)-2-oxoethyl]cyclohexane-1-carboxamide |
| PubChem CID | 62782674 |
| Molecular Formula | C12H23N3O2 |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.18 |
| IUPAC Name | 3-amino-N,2-dimethyl-N-[2-(methylamino)-2-oxoethyl]cyclohexane-1-carboxamide |
| SMILES | CNC(=O)CN(C)C(=O)C1CCCC(N)C1C |
| InChI | InChI=1S/C12H23N3O2/c1-8-9(5-4-6-10(8)13)12(17)15(3)7-11(16)14-2/h8-10H,4-7,13H2,1-3H3,(H,14,16) |
| InChIKey | ARXXITFEESMHBQ-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-amino-N,2-dimethyl-N-[2-(methylamino)-2-oxoethyl]cyclohexane-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-N,2-dimethyl-N-[2-(methylamino)-2-oxoethyl]cyclohexane-1-carboxamide?
The IUPAC name of 3-amino-N,2-dimethyl-N-[2-(methylamino)-2-oxoethyl]cyclohexane-1-carboxamide (CID 62782674) is 3-amino-N,2-dimethyl-N-[2-(methylamino)-2-oxoethyl]cyclohexane-1-carboxamide.
What is the SMILES notation for 3-amino-N,2-dimethyl-N-[2-(methylamino)-2-oxoethyl]cyclohexane-1-carboxamide?
The canonical SMILES for 3-amino-N,2-dimethyl-N-[2-(methylamino)-2-oxoethyl]cyclohexane-1-carboxamide is CNC(=O)CN(C)C(=O)C1CCCC(N)C1C.
What is the InChIKey of 3-amino-N,2-dimethyl-N-[2-(methylamino)-2-oxoethyl]cyclohexane-1-carboxamide?
The InChIKey is ARXXITFEESMHBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23N3O2/c1-8-9(5-4-6-10(8)13)12(17)15(3)7-11(16)14-2/h8-10H,4-7,13H2,1-3H3,(H,14,16).
What are the key properties of 3-amino-N,2-dimethyl-N-[2-(methylamino)-2-oxoethyl]cyclohexane-1-carboxamide?
3-amino-N,2-dimethyl-N-[2-(methylamino)-2-oxoethyl]cyclohexane-1-carboxamide has a molecular weight of 241.33 g/mol, XLogP of -0.05, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-N,2-dimethyl-N-[2-(methylamino)-2-oxoethyl]cyclohexane-1-carboxamide is sourced from PubChem (CID 62782674), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).