C12H13N3O2 — CID 103979455
2-(1H-imidazo[4,5-b]pyridin-2-yl)cyclopentane-1-carboxylic acid (PubChem CID 103979455) has the molecular formula C12H13N3O2 and a molecular weight of 231.25 g/mol. Its IUPAC name is 2-(1H-imidazo[4,5-b]pyridin-2-yl)cyclopentane-1-carboxylic acid.
| Compound Name | 2-(1H-imidazo[4,5-b]pyridin-2-yl)cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 103979455 |
| Molecular Formula | C12H13N3O2 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.10 |
| IUPAC Name | 2-(1H-imidazo[4,5-b]pyridin-2-yl)cyclopentane-1-carboxylic acid |
| SMILES | O=C(O)C1CCCC1c1nc2ncccc2[nH]1 |
| InChI | InChI=1S/C12H13N3O2/c16-12(17)8-4-1-3-7(8)10-14-9-5-2-6-13-11(9)15-10/h2,5-8H,1,3-4H2,(H,16,17)(H,13,14,15) |
| InChIKey | PLXYQJPWPWIPKV-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |