C10H18O2S — CID 10397957
2-[(3R,4S)-4-methylthiolan-3-yl]oxyoxane (PubChem CID 10397957) has the molecular formula C10H18O2S and a molecular weight of 202.32 g/mol. Its IUPAC name is 2-[(3R,4S)-4-methylthiolan-3-yl]oxyoxane.
| Compound Name | 2-[(3R,4S)-4-methylthiolan-3-yl]oxyoxane |
|---|---|
| PubChem CID | 10397957 |
| Molecular Formula | C10H18O2S |
| Molecular Weight | 202.32 g/mol |
| Exact Mass | 202.10 |
| IUPAC Name | 2-[(3R,4S)-4-methylthiolan-3-yl]oxyoxane |
| SMILES | C[C@@H]1CSC[C@@H]1OC1CCCCO1 |
| InChI | InChI=1S/C10H18O2S/c1-8-6-13-7-9(8)12-10-4-2-3-5-11-10/h8-10H,2-7H2,1H3/t8-,9+,10?/m1/s1 |
| InChIKey | UPSYALGUNBTAGK-ZDGBYWQASA-N |
| XLogP | 2.28 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.32 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |