C16H32N2O2 — CID 103980373
tert-butyl 4-(pentan-2-ylamino)azepane-1-carboxylate (PubChem CID 103980373) has the molecular formula C16H32N2O2 and a molecular weight of 284.44 g/mol. Its IUPAC name is tert-butyl 4-(pentan-2-ylamino)azepane-1-carboxylate.
| Compound Name | tert-butyl 4-(pentan-2-ylamino)azepane-1-carboxylate |
|---|---|
| PubChem CID | 103980373 |
| Molecular Formula | C16H32N2O2 |
| Molecular Weight | 284.44 g/mol |
| Exact Mass | 284.25 |
| IUPAC Name | tert-butyl 4-(pentan-2-ylamino)azepane-1-carboxylate |
| SMILES | CCCC(C)NC1CCCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C16H32N2O2/c1-6-8-13(2)17-14-9-7-11-18(12-10-14)15(19)20-16(3,4)5/h13-14,17H,6-12H2,1-5H3 |
| InChIKey | JDYQPWYJMMRTIJ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.44 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |