C15H31N3O2 — CID 82944881
tert-butyl 3-[1-(dimethylamino)propan-2-ylamino]piperidine-1-carboxylate (PubChem CID 82944881) has the molecular formula C15H31N3O2 and a molecular weight of 285.43 g/mol. Its IUPAC name is tert-butyl 3-[1-(dimethylamino)propan-2-ylamino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[1-(dimethylamino)propan-2-ylamino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 82944881 |
| Molecular Formula | C15H31N3O2 |
| Molecular Weight | 285.43 g/mol |
| Exact Mass | 285.24 |
| IUPAC Name | tert-butyl 3-[1-(dimethylamino)propan-2-ylamino]piperidine-1-carboxylate |
| SMILES | CC(CN(C)C)NC1CCCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C15H31N3O2/c1-12(10-17(5)6)16-13-8-7-9-18(11-13)14(19)20-15(2,3)4/h12-13,16H,7-11H2,1-6H3 |
| InChIKey | JLCKCNIDKBBTRV-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.43 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |