C15H24FNO — CID 103984394
2-(ethoxymethyl)-3-(2-fluorophenyl)-N-propan-2-ylpropan-1-amine (PubChem CID 103984394) has the molecular formula C15H24FNO and a molecular weight of 253.36 g/mol. Its IUPAC name is 2-(ethoxymethyl)-3-(2-fluorophenyl)-N-propan-2-ylpropan-1-amine.
| Compound Name | 2-(ethoxymethyl)-3-(2-fluorophenyl)-N-propan-2-ylpropan-1-amine |
|---|---|
| PubChem CID | 103984394 |
| Molecular Formula | C15H24FNO |
| Molecular Weight | 253.36 g/mol |
| Exact Mass | 253.18 |
| IUPAC Name | 2-(ethoxymethyl)-3-(2-fluorophenyl)-N-propan-2-ylpropan-1-amine |
| SMILES | CCOCC(CNC(C)C)Cc1ccccc1F |
| InChI | InChI=1S/C15H24FNO/c1-4-18-11-13(10-17-12(2)3)9-14-7-5-6-8-15(14)16/h5-8,12-13,17H,4,9-11H2,1-3H3 |
| InChIKey | NQPQFYTUICEDCH-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.36 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |