C17H28FNO — CID 106456726
N-ethyl-2-[(2-fluorophenyl)methyl]-4-(2-methylpropoxy)butan-1-amine (PubChem CID 106456726) has the molecular formula C17H28FNO and a molecular weight of 281.41 g/mol. Its IUPAC name is N-ethyl-2-[(2-fluorophenyl)methyl]-4-(2-methylpropoxy)butan-1-amine.
| Compound Name | N-ethyl-2-[(2-fluorophenyl)methyl]-4-(2-methylpropoxy)butan-1-amine |
|---|---|
| PubChem CID | 106456726 |
| Molecular Formula | C17H28FNO |
| Molecular Weight | 281.41 g/mol |
| Exact Mass | 281.22 |
| IUPAC Name | N-ethyl-2-[(2-fluorophenyl)methyl]-4-(2-methylpropoxy)butan-1-amine |
| SMILES | CCNCC(CCOCC(C)C)Cc1ccccc1F |
| InChI | InChI=1S/C17H28FNO/c1-4-19-12-15(9-10-20-13-14(2)3)11-16-7-5-6-8-17(16)18/h5-8,14-15,19H,4,9-13H2,1-3H3 |
| InChIKey | CEXBGKZDNZCGNF-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.41 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|