C18H30FNO — CID 115943381
2-[(2-fluorophenyl)methyl]-4-[(2-methylpropan-2-yl)oxy]-N-propylbutan-1-amine (PubChem CID 115943381) has the molecular formula C18H30FNO and a molecular weight of 295.44 g/mol. Its IUPAC name is 2-[(2-fluorophenyl)methyl]-4-[(2-methylpropan-2-yl)oxy]-N-propylbutan-1-amine.
| Compound Name | 2-[(2-fluorophenyl)methyl]-4-[(2-methylpropan-2-yl)oxy]-N-propylbutan-1-amine |
|---|---|
| PubChem CID | 115943381 |
| Molecular Formula | C18H30FNO |
| Molecular Weight | 295.44 g/mol |
| Exact Mass | 295.23 |
| IUPAC Name | 2-[(2-fluorophenyl)methyl]-4-[(2-methylpropan-2-yl)oxy]-N-propylbutan-1-amine |
| SMILES | CCCNCC(CCOC(C)(C)C)Cc1ccccc1F |
| InChI | InChI=1S/C18H30FNO/c1-5-11-20-14-15(10-12-21-18(2,3)4)13-16-8-6-7-9-17(16)19/h6-9,15,20H,5,10-14H2,1-4H3 |
| InChIKey | UXLITIPCWVORLF-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.44 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|