C10H19NO2 — CID 103986754
1,2-bis(oxolan-3-yl)ethanamine (PubChem CID 103986754) has the molecular formula C10H19NO2 and a molecular weight of 185.27 g/mol. Its IUPAC name is 1,2-bis(oxolan-3-yl)ethanamine.
| Compound Name | 1,2-bis(oxolan-3-yl)ethanamine |
|---|---|
| PubChem CID | 103986754 |
| Molecular Formula | C10H19NO2 |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.14 |
| IUPAC Name | 1,2-bis(oxolan-3-yl)ethanamine |
| SMILES | NC(CC1CCOC1)C1CCOC1 |
| InChI | InChI=1S/C10H19NO2/c11-10(9-2-4-13-7-9)5-8-1-3-12-6-8/h8-10H,1-7,11H2 |
| InChIKey | KLPCEYWACFLNAB-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |