C8H18N2O — CID 126685843
1-(oxolan-3-yl)butane-2,3-diamine (PubChem CID 126685843) has the molecular formula C8H18N2O and a molecular weight of 158.25 g/mol. Its IUPAC name is 1-(oxolan-3-yl)butane-2,3-diamine.
| Compound Name | 1-(oxolan-3-yl)butane-2,3-diamine |
|---|---|
| PubChem CID | 126685843 |
| Molecular Formula | C8H18N2O |
| Molecular Weight | 158.25 g/mol |
| Exact Mass | 158.14 |
| IUPAC Name | 1-(oxolan-3-yl)butane-2,3-diamine |
| SMILES | CC(N)C(N)CC1CCOC1 |
| InChI | InChI=1S/C8H18N2O/c1-6(9)8(10)4-7-2-3-11-5-7/h6-8H,2-5,9-10H2,1H3 |
| InChIKey | VCWQMAMBJBLFAK-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.25 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |