C13H20N4O2 — CID 103989960
N-[(1,4-dimethylpiperidin-4-yl)methyl]-2-nitropyridin-3-amine (PubChem CID 103989960) has the molecular formula C13H20N4O2 and a molecular weight of 264.33 g/mol. Its IUPAC name is N-[(1,4-dimethylpiperidin-4-yl)methyl]-2-nitropyridin-3-amine.
| Compound Name | N-[(1,4-dimethylpiperidin-4-yl)methyl]-2-nitropyridin-3-amine |
|---|---|
| PubChem CID | 103989960 |
| Molecular Formula | C13H20N4O2 |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.16 |
| IUPAC Name | N-[(1,4-dimethylpiperidin-4-yl)methyl]-2-nitropyridin-3-amine |
| SMILES | CN1CCC(C)(CNc2cccnc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C13H20N4O2/c1-13(5-8-16(2)9-6-13)10-15-11-4-3-7-14-12(11)17(18)19/h3-4,7,15H,5-6,8-10H2,1-2H3 |
| InChIKey | UDEQABVZHIYNEM-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 71.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|