C15H23N3O3 — CID 103989943
N-[(1,4-dimethylpiperidin-4-yl)methyl]-4-methoxy-2-nitroaniline (PubChem CID 103989943) has the molecular formula C15H23N3O3 and a molecular weight of 293.37 g/mol. Its IUPAC name is N-[(1,4-dimethylpiperidin-4-yl)methyl]-4-methoxy-2-nitroaniline.
| Compound Name | N-[(1,4-dimethylpiperidin-4-yl)methyl]-4-methoxy-2-nitroaniline |
|---|---|
| PubChem CID | 103989943 |
| Molecular Formula | C15H23N3O3 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.17 |
| IUPAC Name | N-[(1,4-dimethylpiperidin-4-yl)methyl]-4-methoxy-2-nitroaniline |
| SMILES | COc1ccc(NCC2(C)CCN(C)CC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H23N3O3/c1-15(6-8-17(2)9-7-15)11-16-13-5-4-12(21-3)10-14(13)18(19)20/h4-5,10,16H,6-9,11H2,1-3H3 |
| InChIKey | HXVQRCAJZLKLKB-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 67.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|