C12H17N3O3 — CID 103353990
N-[(1-aminocyclobutyl)methyl]-4-methoxy-2-nitroaniline (PubChem CID 103353990) has the molecular formula C12H17N3O3 and a molecular weight of 251.29 g/mol. Its IUPAC name is N-[(1-aminocyclobutyl)methyl]-4-methoxy-2-nitroaniline.
| Compound Name | N-[(1-aminocyclobutyl)methyl]-4-methoxy-2-nitroaniline |
|---|---|
| PubChem CID | 103353990 |
| Molecular Formula | C12H17N3O3 |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | N-[(1-aminocyclobutyl)methyl]-4-methoxy-2-nitroaniline |
| SMILES | COc1ccc(NCC2(N)CCC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H17N3O3/c1-18-9-3-4-10(11(7-9)15(16)17)14-8-12(13)5-2-6-12/h3-4,7,14H,2,5-6,8,13H2,1H3 |
| InChIKey | SIQQOHWHEIRPFA-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 90.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|