C14H22N2O4 — CID 104624092
4-methoxy-N-(4-methoxy-2,2-dimethylbutyl)-2-nitroaniline (PubChem CID 104624092) has the molecular formula C14H22N2O4 and a molecular weight of 282.34 g/mol. Its IUPAC name is 4-methoxy-N-(4-methoxy-2,2-dimethylbutyl)-2-nitroaniline.
| Compound Name | 4-methoxy-N-(4-methoxy-2,2-dimethylbutyl)-2-nitroaniline |
|---|---|
| PubChem CID | 104624092 |
| Molecular Formula | C14H22N2O4 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | 4-methoxy-N-(4-methoxy-2,2-dimethylbutyl)-2-nitroaniline |
| SMILES | COCCC(C)(C)CNc1ccc(OC)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H22N2O4/c1-14(2,7-8-19-3)10-15-12-6-5-11(20-4)9-13(12)16(17)18/h5-6,9,15H,7-8,10H2,1-4H3 |
| InChIKey | OXWRIKXSNVYJQV-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|