C16H24N4O4 — CID 120771478
2-[3-(aminomethyl)-3-methylpyrrolidin-1-yl]-N-(4-methoxy-2-nitrophenyl)propanamide (PubChem CID 120771478) has the molecular formula C16H24N4O4 and a molecular weight of 336.39 g/mol. Its IUPAC name is 2-[3-(aminomethyl)-3-methylpyrrolidin-1-yl]-N-(4-methoxy-2-nitrophenyl)propanamide.
| Compound Name | 2-[3-(aminomethyl)-3-methylpyrrolidin-1-yl]-N-(4-methoxy-2-nitrophenyl)propanamide |
|---|---|
| PubChem CID | 120771478 |
| Molecular Formula | C16H24N4O4 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | 2-[3-(aminomethyl)-3-methylpyrrolidin-1-yl]-N-(4-methoxy-2-nitrophenyl)propanamide |
| SMILES | COc1ccc(NC(=O)C(C)N2CCC(C)(CN)C2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H24N4O4/c1-11(19-7-6-16(2,9-17)10-19)15(21)18-13-5-4-12(24-3)8-14(13)20(22)23/h4-5,8,11H,6-7,9-10,17H2,1-3H3,(H,18,21) |
| InChIKey | CCUNTIDUYMCFLT-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 110.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|