C21H25FN4O4 — CID 87019587
2-[4-(4-fluorophenyl)-1,4-diazepan-1-yl]-N-(4-methoxy-2-nitrophenyl)propanamide (PubChem CID 87019587) has the molecular formula C21H25FN4O4 and a molecular weight of 416.45 g/mol. Its IUPAC name is 2-[4-(4-fluorophenyl)-1,4-diazepan-1-yl]-N-(4-methoxy-2-nitrophenyl)propanamide.
| Compound Name | 2-[4-(4-fluorophenyl)-1,4-diazepan-1-yl]-N-(4-methoxy-2-nitrophenyl)propanamide |
|---|---|
| PubChem CID | 87019587 |
| Molecular Formula | C21H25FN4O4 |
| Molecular Weight | 416.45 g/mol |
| Exact Mass | 416.19 |
| IUPAC Name | 2-[4-(4-fluorophenyl)-1,4-diazepan-1-yl]-N-(4-methoxy-2-nitrophenyl)propanamide |
| SMILES | COc1ccc(NC(=O)C(C)N2CCCN(c3ccc(F)cc3)CC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H25FN4O4/c1-15(21(27)23-19-9-8-18(30-2)14-20(19)26(28)29)24-10-3-11-25(13-12-24)17-6-4-16(22)5-7-17/h4-9,14-15H,3,10-13H2,1-2H3,(H,23,27) |
| InChIKey | AWHXOBKSCWYDJD-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 87.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.45 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|