C9H18F3NO — CID 103993563
2,3-dimethyl-3-(3,3,3-trifluoropropylamino)butan-2-ol (PubChem CID 103993563) has the molecular formula C9H18F3NO and a molecular weight of 213.24 g/mol. Its IUPAC name is 2,3-dimethyl-3-(3,3,3-trifluoropropylamino)butan-2-ol.
| Compound Name | 2,3-dimethyl-3-(3,3,3-trifluoropropylamino)butan-2-ol |
|---|---|
| PubChem CID | 103993563 |
| Molecular Formula | C9H18F3NO |
| Molecular Weight | 213.24 g/mol |
| Exact Mass | 213.13 |
| IUPAC Name | 2,3-dimethyl-3-(3,3,3-trifluoropropylamino)butan-2-ol |
| SMILES | CC(C)(O)C(C)(C)NCCC(F)(F)F |
| InChI | InChI=1S/C9H18F3NO/c1-7(2,8(3,4)14)13-6-5-9(10,11)12/h13-14H,5-6H2,1-4H3 |
| InChIKey | UMMIGPBCDFKSKS-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.24 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |