C16H25N3 — CID 103997998
5-[(4-propylpiperazin-1-yl)methyl]-2,3-dihydro-1H-isoindole (PubChem CID 103997998) has the molecular formula C16H25N3 and a molecular weight of 259.40 g/mol. Its IUPAC name is 5-[(4-propylpiperazin-1-yl)methyl]-2,3-dihydro-1H-isoindole.
| Compound Name | 5-[(4-propylpiperazin-1-yl)methyl]-2,3-dihydro-1H-isoindole |
|---|---|
| PubChem CID | 103997998 |
| Molecular Formula | C16H25N3 |
| Molecular Weight | 259.40 g/mol |
| Exact Mass | 259.20 |
| IUPAC Name | 5-[(4-propylpiperazin-1-yl)methyl]-2,3-dihydro-1H-isoindole |
| SMILES | CCCN1CCN(Cc2ccc3c(c2)CNC3)CC1 |
| InChI | InChI=1S/C16H25N3/c1-2-5-18-6-8-19(9-7-18)13-14-3-4-15-11-17-12-16(15)10-14/h3-4,10,17H,2,5-9,11-13H2,1H3 |
| InChIKey | MXIQSHSVCANRCT-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.40 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |