C14H21B82N3 — CID 159268606
CID 159268606 (PubChem CID 159268606) has the molecular formula C14H21B82N3 and a molecular weight of 1117.93 g/mol.
| Compound Name | CID 159268606 |
|---|---|
| PubChem CID | 159268606 |
| Molecular Formula | C14H21B82N3 |
| Molecular Weight | 1117.93 g/mol |
| Exact Mass | 1133.94 |
| IUPAC Name | — |
| SMILES | CN1CCN(Cc2ccc3c(c2)CNC3)CC1.[B]B([B])B(B([B])[B])B(B([B])[B])B(B(B([B])[B])B([B])[B])B(B(B(B(B([B])[B])B([B])[B])B(B([B])[B])B([B])[B])B(B(B([B])[B])B([B])[B])B(B([B])[B])B([B])[B])B(B(B(B([B])[B])B([B])[B])B(B([B])[B])B([B])[B])B(B(B([B])[B])B([B])[B])B(B([B])[B])B([B])[B] |
| InChI | InChI=1S/C14H21N3.B82/c1-16-4-6-17(7-5-16)11-12-2-3-13-9-15-10-14(13)8-12;1-43(2)64(44(3)4)74(63(41)42)79(73(61(37)38)62(39)40)82(80(75(65(45(5)6)46(7)8)66(47(9)10)48(11)12)76(67(49(13)14)50(15)16)68(51(17)18)52(19)20)81(77(69(53(21)22)54(23)24)70(55(25)26)56(27)28)78(71(57(29)30)58(31)32)72(59(33)34)60(35)36/h2-3,8,15H,4-7,9-11H2,1H3; |
| InChIKey | XCOSPSQEFQMCCN-UHFFFAOYSA-N |
| XLogP | -30.19 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 41 |
| Heavy Atoms | 99 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 1117.93 |
| LogP ≤ 5 | -30.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|