C11H14N4OS — CID 10399862
(10S)-4,6-dimethyl-9-sulfanylidene-1,4,5,8-tetrazatricyclo[8.3.0.03,7]trideca-3(7),5-dien-2-one (PubChem CID 10399862) has the molecular formula C11H14N4OS and a molecular weight of 250.33 g/mol. Its IUPAC name is (10S)-4,6-dimethyl-9-sulfanylidene-1,4,5,8-tetrazatricyclo[8.3.0.03,7]trideca-3(7),5-dien-2-one.
| Compound Name | (10S)-4,6-dimethyl-9-sulfanylidene-1,4,5,8-tetrazatricyclo[8.3.0.03,7]trideca-3(7),5-dien-2-one |
|---|---|
| PubChem CID | 10399862 |
| Molecular Formula | C11H14N4OS |
| Molecular Weight | 250.33 g/mol |
| Exact Mass | 250.09 |
| IUPAC Name | (10S)-4,6-dimethyl-9-sulfanylidene-1,4,5,8-tetrazatricyclo[8.3.0.03,7]trideca-3(7),5-dien-2-one |
| SMILES | Cc1nn(C)c2c1NC(=S)[C@@H]1CCCN1C2=O |
| InChI | InChI=1S/C11H14N4OS/c1-6-8-9(14(2)13-6)11(16)15-5-3-4-7(15)10(17)12-8/h7H,3-5H2,1-2H3,(H,12,17)/t7-/m0/s1 |
| InChIKey | JUUJHDOLFQBKCR-ZETCQYMHSA-N |
| XLogP | 1.09 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.33 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|