C10H9IN2OS2 — CID 10090147
(10S)-5-iodo-9-sulfanylidene-6-thia-1,8-diazatricyclo[8.3.0.03,7]trideca-3(7),4-dien-2-one (PubChem CID 10090147) has the molecular formula C10H9IN2OS2 and a molecular weight of 364.23 g/mol. Its IUPAC name is (10S)-5-iodo-9-sulfanylidene-6-thia-1,8-diazatricyclo[8.3.0.03,7]trideca-3(7),4-dien-2-one.
| Compound Name | (10S)-5-iodo-9-sulfanylidene-6-thia-1,8-diazatricyclo[8.3.0.03,7]trideca-3(7),4-dien-2-one |
|---|---|
| PubChem CID | 10090147 |
| Molecular Formula | C10H9IN2OS2 |
| Molecular Weight | 364.23 g/mol |
| Exact Mass | 363.92 |
| IUPAC Name | (10S)-5-iodo-9-sulfanylidene-6-thia-1,8-diazatricyclo[8.3.0.03,7]trideca-3(7),4-dien-2-one |
| SMILES | O=C1c2cc(I)sc2NC(=S)[C@@H]2CCCN12 |
| InChI | InChI=1S/C10H9IN2OS2/c11-7-4-5-9(16-7)12-8(15)6-2-1-3-13(6)10(5)14/h4,6H,1-3H2,(H,12,15)/t6-/m0/s1 |
| InChIKey | FBSRPTAEYHDSKY-LURJTMIESA-N |
| XLogP | 2.71 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.23 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|