C11H16N2S3 — CID 101368908
(8aS)-spiro[6,7,8,8a-tetrahydro-2H-pyrrolo[1,2-a]pyrazine-3,4'-thiane]-1,4-dithione (PubChem CID 101368908) has the molecular formula C11H16N2S3 and a molecular weight of 272.46 g/mol. Its IUPAC name is (8aS)-spiro[6,7,8,8a-tetrahydro-2H-pyrrolo[1,2-a]pyrazine-3,4'-thiane]-1,4-dithione.
| Compound Name | (8aS)-spiro[6,7,8,8a-tetrahydro-2H-pyrrolo[1,2-a]pyrazine-3,4'-thiane]-1,4-dithione |
|---|---|
| PubChem CID | 101368908 |
| Molecular Formula | C11H16N2S3 |
| Molecular Weight | 272.46 g/mol |
| Exact Mass | 272.05 |
| IUPAC Name | (8aS)-spiro[6,7,8,8a-tetrahydro-2H-pyrrolo[1,2-a]pyrazine-3,4'-thiane]-1,4-dithione |
| SMILES | S=C1NC2(CCSCC2)C(=S)N2CCC[C@@H]12 |
| InChI | InChI=1S/C11H16N2S3/c14-9-8-2-1-5-13(8)10(15)11(12-9)3-6-16-7-4-11/h8H,1-7H2,(H,12,14)/t8-/m0/s1 |
| InChIKey | QOKVRQRANVBIEN-QMMMGPOBSA-N |
| XLogP | 1.97 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.46 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|