C11H11IN2O — CID 79290980
7-iodo-2,3,3a,5-tetrahydro-1H-pyrrolo[1,2-a]quinoxalin-4-one (PubChem CID 79290980) has the molecular formula C11H11IN2O and a molecular weight of 314.13 g/mol. Its IUPAC name is 7-iodo-2,3,3a,5-tetrahydro-1H-pyrrolo[1,2-a]quinoxalin-4-one.
| Compound Name | 7-iodo-2,3,3a,5-tetrahydro-1H-pyrrolo[1,2-a]quinoxalin-4-one |
|---|---|
| PubChem CID | 79290980 |
| Molecular Formula | C11H11IN2O |
| Molecular Weight | 314.13 g/mol |
| Exact Mass | 313.99 |
| IUPAC Name | 7-iodo-2,3,3a,5-tetrahydro-1H-pyrrolo[1,2-a]quinoxalin-4-one |
| SMILES | O=C1Nc2cc(I)ccc2N2CCCC12 |
| InChI | InChI=1S/C11H11IN2O/c12-7-3-4-9-8(6-7)13-11(15)10-2-1-5-14(9)10/h3-4,6,10H,1-2,5H2,(H,13,15) |
| InChIKey | WOIFADJQIOSEHM-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.13 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|