C14H11IN2OS — CID 79296309
5-iodo-14-thia-1,8-diazatetracyclo[8.7.0.02,7.011,15]heptadeca-2(7),3,5,11(15),12-pentaen-9-one (PubChem CID 79296309) has the molecular formula C14H11IN2OS and a molecular weight of 382.23 g/mol. Its IUPAC name is 5-iodo-14-thia-1,8-diazatetracyclo[8.7.0.02,7.011,15]heptadeca-2(7),3,5,11(15),12-pentaen-9-one.
| Compound Name | 5-iodo-14-thia-1,8-diazatetracyclo[8.7.0.02,7.011,15]heptadeca-2(7),3,5,11(15),12-pentaen-9-one |
|---|---|
| PubChem CID | 79296309 |
| Molecular Formula | C14H11IN2OS |
| Molecular Weight | 382.23 g/mol |
| Exact Mass | 381.96 |
| IUPAC Name | 5-iodo-14-thia-1,8-diazatetracyclo[8.7.0.02,7.011,15]heptadeca-2(7),3,5,11(15),12-pentaen-9-one |
| SMILES | O=C1Nc2cc(I)ccc2N2CCc3sccc3C12 |
| InChI | InChI=1S/C14H11IN2OS/c15-8-1-2-11-10(7-8)16-14(18)13-9-4-6-19-12(9)3-5-17(11)13/h1-2,4,6-7,13H,3,5H2,(H,16,18) |
| InChIKey | CIWBQTGNCJPZBY-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.23 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|