C12H13IN2O2S — CID 105357267
9-iodo-3-oxo-1,2,4,4a,5,7-hexahydro-[1,4]thiazino[4,3-a][1,5]benzodiazepin-6-one (PubChem CID 105357267) has the molecular formula C12H13IN2O2S and a molecular weight of 376.22 g/mol. Its IUPAC name is 9-iodo-3-oxo-1,2,4,4a,5,7-hexahydro-[1,4]thiazino[4,3-a][1,5]benzodiazepin-6-one.
| Compound Name | 9-iodo-3-oxo-1,2,4,4a,5,7-hexahydro-[1,4]thiazino[4,3-a][1,5]benzodiazepin-6-one |
|---|---|
| PubChem CID | 105357267 |
| Molecular Formula | C12H13IN2O2S |
| Molecular Weight | 376.22 g/mol |
| Exact Mass | 375.97 |
| IUPAC Name | 9-iodo-3-oxo-1,2,4,4a,5,7-hexahydro-[1,4]thiazino[4,3-a][1,5]benzodiazepin-6-one |
| SMILES | O=C1CC2CS(=O)CCN2c2ccc(I)cc2N1 |
| InChI | InChI=1S/C12H13IN2O2S/c13-8-1-2-11-10(5-8)14-12(16)6-9-7-18(17)4-3-15(9)11/h1-2,5,9H,3-4,6-7H2,(H,14,16) |
| InChIKey | BUDHWHOSVJLSAZ-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.22 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|