C18H19FN4O3S — CID 53240924
2-fluoro-N-(6-oxo-2,3,4,4a,5,7-hexahydro-1H-pyrazino[1,2-a][1,5]benzodiazepin-9-yl)benzenesulfonamide (PubChem CID 53240924) has the molecular formula C18H19FN4O3S and a molecular weight of 390.44 g/mol. Its IUPAC name is 2-fluoro-N-(6-oxo-2,3,4,4a,5,7-hexahydro-1H-pyrazino[1,2-a][1,5]benzodiazepin-9-yl)benzenesulfonamide.
| Compound Name | 2-fluoro-N-(6-oxo-2,3,4,4a,5,7-hexahydro-1H-pyrazino[1,2-a][1,5]benzodiazepin-9-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 53240924 |
| Molecular Formula | C18H19FN4O3S |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | 2-fluoro-N-(6-oxo-2,3,4,4a,5,7-hexahydro-1H-pyrazino[1,2-a][1,5]benzodiazepin-9-yl)benzenesulfonamide |
| SMILES | O=C1CC2CNCCN2c2ccc(NS(=O)(=O)c3ccccc3F)cc2N1 |
| InChI | InChI=1S/C18H19FN4O3S/c19-14-3-1-2-4-17(14)27(25,26)22-12-5-6-16-15(9-12)21-18(24)10-13-11-20-7-8-23(13)16/h1-6,9,13,20,22H,7-8,10-11H2,(H,21,24) |
| InChIKey | SFDXNIDGFDDEBV-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |