C18H20N4O3S — CID 154506875
2-(6-oxo-2,3,4,4a,5,7-hexahydro-1H-pyrazino[1,2-a][1,5]benzodiazepin-9-yl)benzenesulfonamide (PubChem CID 154506875) has the molecular formula C18H20N4O3S and a molecular weight of 372.45 g/mol. Its IUPAC name is 2-(6-oxo-2,3,4,4a,5,7-hexahydro-1H-pyrazino[1,2-a][1,5]benzodiazepin-9-yl)benzenesulfonamide.
| Compound Name | 2-(6-oxo-2,3,4,4a,5,7-hexahydro-1H-pyrazino[1,2-a][1,5]benzodiazepin-9-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 154506875 |
| Molecular Formula | C18H20N4O3S |
| Molecular Weight | 372.45 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | 2-(6-oxo-2,3,4,4a,5,7-hexahydro-1H-pyrazino[1,2-a][1,5]benzodiazepin-9-yl)benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccccc1-c1ccc2c(c1)NC(=O)CC1CNCCN21 |
| InChI | InChI=1S/C18H20N4O3S/c19-26(24,25)17-4-2-1-3-14(17)12-5-6-16-15(9-12)21-18(23)10-13-11-20-7-8-22(13)16/h1-6,9,13,20H,7-8,10-11H2,(H,21,23)(H2,19,24,25) |
| InChIKey | QPEKKRRAMGWFTN-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.45 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |