C20H20ClN3O — CID 67250200
10-[2-(3-chlorophenyl)ethenyl]-2,3,4,4a,5,7-hexahydro-1H-pyrazino[1,2-a][1,5]benzodiazepin-6-one (PubChem CID 67250200) has the molecular formula C20H20ClN3O and a molecular weight of 353.85 g/mol. Its IUPAC name is 10-[2-(3-chlorophenyl)ethenyl]-2,3,4,4a,5,7-hexahydro-1H-pyrazino[1,2-a][1,5]benzodiazepin-6-one.
| Compound Name | 10-[2-(3-chlorophenyl)ethenyl]-2,3,4,4a,5,7-hexahydro-1H-pyrazino[1,2-a][1,5]benzodiazepin-6-one |
|---|---|
| PubChem CID | 67250200 |
| Molecular Formula | C20H20ClN3O |
| Molecular Weight | 353.85 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | 10-[2-(3-chlorophenyl)ethenyl]-2,3,4,4a,5,7-hexahydro-1H-pyrazino[1,2-a][1,5]benzodiazepin-6-one |
| SMILES | O=C1CC2CNCCN2c2cc(C=Cc3cccc(Cl)c3)ccc2N1 |
| InChI | InChI=1S/C20H20ClN3O/c21-16-3-1-2-14(10-16)4-5-15-6-7-18-19(11-15)24-9-8-22-13-17(24)12-20(25)23-18/h1-7,10-11,17,22H,8-9,12-13H2,(H,23,25) |
| InChIKey | GJZKILVNRMUNLT-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.85 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|