C12H13ClN2O — CID 68689145
8-chloro-1,2,3,4,11,11a-hexahydropyrazino[1,2-b]isoquinolin-6-one (PubChem CID 68689145) has the molecular formula C12H13ClN2O and a molecular weight of 236.70 g/mol. Its IUPAC name is 8-chloro-1,2,3,4,11,11a-hexahydropyrazino[1,2-b]isoquinolin-6-one.
| Compound Name | 8-chloro-1,2,3,4,11,11a-hexahydropyrazino[1,2-b]isoquinolin-6-one |
|---|---|
| PubChem CID | 68689145 |
| Molecular Formula | C12H13ClN2O |
| Molecular Weight | 236.70 g/mol |
| Exact Mass | 236.07 |
| IUPAC Name | 8-chloro-1,2,3,4,11,11a-hexahydropyrazino[1,2-b]isoquinolin-6-one |
| SMILES | O=C1c2cc(Cl)ccc2CC2CNCCN12 |
| InChI | InChI=1S/C12H13ClN2O/c13-9-2-1-8-5-10-7-14-3-4-15(10)12(16)11(8)6-9/h1-2,6,10,14H,3-5,7H2 |
| InChIKey | UMHOHNRDOOBXDJ-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.70 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |