C14H14ClF3N2O2 — CID 158683550
(11aR)-8-chloro-1,2,3,4,11,11a-hexahydropyrazino[1,2-b]isoquinolin-6-one;2,2,2-trifluoroacetaldehyde (PubChem CID 158683550) has the molecular formula C14H14ClF3N2O2 and a molecular weight of 334.73 g/mol. Its IUPAC name is (11aR)-8-chloro-1,2,3,4,11,11a-hexahydropyrazino[1,2-b]isoquinolin-6-one;2,2,2-trifluoroacetaldehyde.
| Compound Name | (11aR)-8-chloro-1,2,3,4,11,11a-hexahydropyrazino[1,2-b]isoquinolin-6-one;2,2,2-trifluoroacetaldehyde |
|---|---|
| PubChem CID | 158683550 |
| Molecular Formula | C14H14ClF3N2O2 |
| Molecular Weight | 334.73 g/mol |
| Exact Mass | 334.07 |
| IUPAC Name | (11aR)-8-chloro-1,2,3,4,11,11a-hexahydropyrazino[1,2-b]isoquinolin-6-one;2,2,2-trifluoroacetaldehyde |
| SMILES | O=C1c2cc(Cl)ccc2C[C@@H]2CNCCN12.O=CC(F)(F)F |
| InChI | InChI=1S/C12H13ClN2O.C2HF3O/c13-9-2-1-8-5-10-7-14-3-4-15(10)12(16)11(8)6-9;3-2(4,5)1-6/h1-2,6,10,14H,3-5,7H2;1H/t10-;/m1./s1 |
| InChIKey | IFLCOTVORFQVNQ-HNCPQSOCSA-N |
| XLogP | 2.06 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.73 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|