C12H13ClN2OS — CID 115472175
10-chloro-1,2,4,4a,5,7-hexahydro-[1,4]thiazino[4,3-a][1,5]benzodiazepin-6-one (PubChem CID 115472175) has the molecular formula C12H13ClN2OS and a molecular weight of 268.77 g/mol. Its IUPAC name is 10-chloro-1,2,4,4a,5,7-hexahydro-[1,4]thiazino[4,3-a][1,5]benzodiazepin-6-one.
| Compound Name | 10-chloro-1,2,4,4a,5,7-hexahydro-[1,4]thiazino[4,3-a][1,5]benzodiazepin-6-one |
|---|---|
| PubChem CID | 115472175 |
| Molecular Formula | C12H13ClN2OS |
| Molecular Weight | 268.77 g/mol |
| Exact Mass | 268.04 |
| IUPAC Name | 10-chloro-1,2,4,4a,5,7-hexahydro-[1,4]thiazino[4,3-a][1,5]benzodiazepin-6-one |
| SMILES | O=C1CC2CSCCN2c2cc(Cl)ccc2N1 |
| InChI | InChI=1S/C12H13ClN2OS/c13-8-1-2-10-11(5-8)15-3-4-17-7-9(15)6-12(16)14-10/h1-2,5,9H,3-4,6-7H2,(H,14,16) |
| InChIKey | WMGRPCJDRFHMEJ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.77 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |