C13H12Cl2N2O2S — CID 107653794
7-(3,5-dichlorophenyl)-3,4,9,9a-tetrahydro-1H-pyrimido[6,1-c][1,4]thiazine-6,8-dione (PubChem CID 107653794) has the molecular formula C13H12Cl2N2O2S and a molecular weight of 331.22 g/mol. Its IUPAC name is 7-(3,5-dichlorophenyl)-3,4,9,9a-tetrahydro-1H-pyrimido[6,1-c][1,4]thiazine-6,8-dione.
| Compound Name | 7-(3,5-dichlorophenyl)-3,4,9,9a-tetrahydro-1H-pyrimido[6,1-c][1,4]thiazine-6,8-dione |
|---|---|
| PubChem CID | 107653794 |
| Molecular Formula | C13H12Cl2N2O2S |
| Molecular Weight | 331.22 g/mol |
| Exact Mass | 330.00 |
| IUPAC Name | 7-(3,5-dichlorophenyl)-3,4,9,9a-tetrahydro-1H-pyrimido[6,1-c][1,4]thiazine-6,8-dione |
| SMILES | O=C1CC2CSCCN2C(=O)N1c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C13H12Cl2N2O2S/c14-8-3-9(15)5-10(4-8)17-12(18)6-11-7-20-2-1-16(11)13(17)19/h3-5,11H,1-2,6-7H2 |
| InChIKey | ZMZHZEPSYPVZOE-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.22 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |