C24H20Cl2N3O3P — CID 134262838
1-(3,5-dichlorophenyl)-3-(2-oxo-1,3-diphenyl-1,3,2λ5-diazaphospholidin-2-yl)pyrrolidine-2,5-dione (PubChem CID 134262838) has the molecular formula C24H20Cl2N3O3P and a molecular weight of 500.32 g/mol. Its IUPAC name is 1-(3,5-dichlorophenyl)-3-(2-oxo-1,3-diphenyl-1,3,2λ5-diazaphospholidin-2-yl)pyrrolidine-2,5-dione.
| Compound Name | 1-(3,5-dichlorophenyl)-3-(2-oxo-1,3-diphenyl-1,3,2λ5-diazaphospholidin-2-yl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 134262838 |
| Molecular Formula | C24H20Cl2N3O3P |
| Molecular Weight | 500.32 g/mol |
| Exact Mass | 499.06 |
| IUPAC Name | 1-(3,5-dichlorophenyl)-3-(2-oxo-1,3-diphenyl-1,3,2λ5-diazaphospholidin-2-yl)pyrrolidine-2,5-dione |
| SMILES | O=C1CC(P2(=O)N(c3ccccc3)CCN2c2ccccc2)C(=O)N1c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C24H20Cl2N3O3P/c25-17-13-18(26)15-21(14-17)29-23(30)16-22(24(29)31)33(32)27(19-7-3-1-4-8-19)11-12-28(33)20-9-5-2-6-10-20/h1-10,13-15,22H,11-12,16H2 |
| InChIKey | JCIVCNLJPPQWLH-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.32 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|