C24H21N4O5P — CID 134262870
1-(4-nitrophenyl)-3-(2-oxo-1,3-diphenyl-1,3,2λ5-diazaphospholidin-2-yl)pyrrolidine-2,5-dione (PubChem CID 134262870) has the molecular formula C24H21N4O5P and a molecular weight of 476.43 g/mol. Its IUPAC name is 1-(4-nitrophenyl)-3-(2-oxo-1,3-diphenyl-1,3,2λ5-diazaphospholidin-2-yl)pyrrolidine-2,5-dione.
| Compound Name | 1-(4-nitrophenyl)-3-(2-oxo-1,3-diphenyl-1,3,2λ5-diazaphospholidin-2-yl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 134262870 |
| Molecular Formula | C24H21N4O5P |
| Molecular Weight | 476.43 g/mol |
| Exact Mass | 476.12 |
| IUPAC Name | 1-(4-nitrophenyl)-3-(2-oxo-1,3-diphenyl-1,3,2λ5-diazaphospholidin-2-yl)pyrrolidine-2,5-dione |
| SMILES | O=C1CC(P2(=O)N(c3ccccc3)CCN2c2ccccc2)C(=O)N1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C24H21N4O5P/c29-23-17-22(24(30)27(23)20-11-13-21(14-12-20)28(31)32)34(33)25(18-7-3-1-4-8-18)15-16-26(34)19-9-5-2-6-10-19/h1-14,22H,15-17H2 |
| InChIKey | FQTYQEIFPMRQKI-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 104.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.43 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|