C27H28N3O3P — CID 134274767
3-[1,3-bis(4-methylphenyl)-2-oxo-1,3,2λ5-diazaphosphinan-2-yl]-1-phenylpyrrolidine-2,5-dione (PubChem CID 134274767) has the molecular formula C27H28N3O3P and a molecular weight of 473.51 g/mol. Its IUPAC name is 3-[1,3-bis(4-methylphenyl)-2-oxo-1,3,2λ5-diazaphosphinan-2-yl]-1-phenylpyrrolidine-2,5-dione.
| Compound Name | 3-[1,3-bis(4-methylphenyl)-2-oxo-1,3,2λ5-diazaphosphinan-2-yl]-1-phenylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 134274767 |
| Molecular Formula | C27H28N3O3P |
| Molecular Weight | 473.51 g/mol |
| Exact Mass | 473.19 |
| IUPAC Name | 3-[1,3-bis(4-methylphenyl)-2-oxo-1,3,2λ5-diazaphosphinan-2-yl]-1-phenylpyrrolidine-2,5-dione |
| SMILES | Cc1ccc(N2CCCN(c3ccc(C)cc3)P2(=O)C2CC(=O)N(c3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C27H28N3O3P/c1-20-9-13-22(14-10-20)28-17-6-18-29(23-15-11-21(2)12-16-23)34(28,33)25-19-26(31)30(27(25)32)24-7-4-3-5-8-24/h3-5,7-16,25H,6,17-19H2,1-2H3 |
| InChIKey | NINUTNKYMWSTOH-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.51 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|