C26H27N3O3P+ — CID 134262848
3-[2-hydroxy-1,3-bis(4-methylphenyl)-1,3,2-diazaphospholidin-2-ium-2-yl]-1-phenylpyrrolidine-2,5-dione (PubChem CID 134262848) has the molecular formula C26H27N3O3P+ and a molecular weight of 460.49 g/mol. Its IUPAC name is 3-[2-hydroxy-1,3-bis(4-methylphenyl)-1,3,2-diazaphospholidin-2-ium-2-yl]-1-phenylpyrrolidine-2,5-dione.
| Compound Name | 3-[2-hydroxy-1,3-bis(4-methylphenyl)-1,3,2-diazaphospholidin-2-ium-2-yl]-1-phenylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 134262848 |
| Molecular Formula | C26H27N3O3P+ |
| Molecular Weight | 460.49 g/mol |
| Exact Mass | 460.18 |
| IUPAC Name | 3-[2-hydroxy-1,3-bis(4-methylphenyl)-1,3,2-diazaphospholidin-2-ium-2-yl]-1-phenylpyrrolidine-2,5-dione |
| SMILES | Cc1ccc(N2CCN(c3ccc(C)cc3)[P+]2(O)C2CC(=O)N(c3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C26H27N3O3P/c1-19-8-12-21(13-9-19)27-16-17-28(22-14-10-20(2)11-15-22)33(27,32)24-18-25(30)29(26(24)31)23-6-4-3-5-7-23/h3-15,24,32H,16-18H2,1-2H3/q+1 |
| InChIKey | DKJVQDBYDGGKBG-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.49 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|