C23H22N4O3P+ — CID 134262810
3-(2-hydroxy-1,3-diphenyl-1,3,2-diazaphospholidin-2-ium-2-yl)-1-pyridin-3-ylpyrrolidine-2,5-dione (PubChem CID 134262810) has the molecular formula C23H22N4O3P+ and a molecular weight of 433.43 g/mol. Its IUPAC name is 3-(2-hydroxy-1,3-diphenyl-1,3,2-diazaphospholidin-2-ium-2-yl)-1-pyridin-3-ylpyrrolidine-2,5-dione.
| Compound Name | 3-(2-hydroxy-1,3-diphenyl-1,3,2-diazaphospholidin-2-ium-2-yl)-1-pyridin-3-ylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 134262810 |
| Molecular Formula | C23H22N4O3P+ |
| Molecular Weight | 433.43 g/mol |
| Exact Mass | 433.14 |
| IUPAC Name | 3-(2-hydroxy-1,3-diphenyl-1,3,2-diazaphospholidin-2-ium-2-yl)-1-pyridin-3-ylpyrrolidine-2,5-dione |
| SMILES | O=C1CC([P+]2(O)N(c3ccccc3)CCN2c2ccccc2)C(=O)N1c1cccnc1 |
| InChI | InChI=1S/C23H22N4O3P/c28-22-16-21(23(29)27(22)20-12-7-13-24-17-20)31(30)25(18-8-3-1-4-9-18)14-15-26(31)19-10-5-2-6-11-19/h1-13,17,21,30H,14-16H2/q+1 |
| InChIKey | GJBRECFREOMIMB-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 76.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.43 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|