C24H22FN3O3P+ — CID 134262767
1-(4-fluorophenyl)-3-(2-hydroxy-1,3-diphenyl-1,3,2-diazaphospholidin-2-ium-2-yl)pyrrolidine-2,5-dione (PubChem CID 134262767) has the molecular formula C24H22FN3O3P+ and a molecular weight of 450.43 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-3-(2-hydroxy-1,3-diphenyl-1,3,2-diazaphospholidin-2-ium-2-yl)pyrrolidine-2,5-dione.
| Compound Name | 1-(4-fluorophenyl)-3-(2-hydroxy-1,3-diphenyl-1,3,2-diazaphospholidin-2-ium-2-yl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 134262767 |
| Molecular Formula | C24H22FN3O3P+ |
| Molecular Weight | 450.43 g/mol |
| Exact Mass | 450.14 |
| IUPAC Name | 1-(4-fluorophenyl)-3-(2-hydroxy-1,3-diphenyl-1,3,2-diazaphospholidin-2-ium-2-yl)pyrrolidine-2,5-dione |
| SMILES | O=C1CC([P+]2(O)N(c3ccccc3)CCN2c2ccccc2)C(=O)N1c1ccc(F)cc1 |
| InChI | InChI=1S/C24H22FN3O3P/c25-18-11-13-21(14-12-18)28-23(29)17-22(24(28)30)32(31)26(19-7-3-1-4-8-19)15-16-27(32)20-9-5-2-6-10-20/h1-14,22,31H,15-17H2/q+1 |
| InChIKey | ADSVGRAWHPVXIY-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.43 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|