C15H14FNO4 — CID 146162889
3-(2,4-dioxopentan-3-yl)-1-(4-fluorophenyl)pyrrolidine-2,5-dione (PubChem CID 146162889) has the molecular formula C15H14FNO4 and a molecular weight of 291.28 g/mol. Its IUPAC name is 3-(2,4-dioxopentan-3-yl)-1-(4-fluorophenyl)pyrrolidine-2,5-dione.
| Compound Name | 3-(2,4-dioxopentan-3-yl)-1-(4-fluorophenyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 146162889 |
| Molecular Formula | C15H14FNO4 |
| Molecular Weight | 291.28 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | 3-(2,4-dioxopentan-3-yl)-1-(4-fluorophenyl)pyrrolidine-2,5-dione |
| SMILES | CC(=O)C(C(C)=O)C1CC(=O)N(c2ccc(F)cc2)C1=O |
| InChI | InChI=1S/C15H14FNO4/c1-8(18)14(9(2)19)12-7-13(20)17(15(12)21)11-5-3-10(16)4-6-11/h3-6,12,14H,7H2,1-2H3 |
| InChIKey | MUFKQALJDDYGCC-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.28 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|