C18H23NO3 — CID 145439446
1-[4-(4-oxopentyl)phenyl]-3-propan-2-ylpyrrolidine-2,5-dione (PubChem CID 145439446) has the molecular formula C18H23NO3 and a molecular weight of 301.39 g/mol. Its IUPAC name is 1-[4-(4-oxopentyl)phenyl]-3-propan-2-ylpyrrolidine-2,5-dione.
| Compound Name | 1-[4-(4-oxopentyl)phenyl]-3-propan-2-ylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 145439446 |
| Molecular Formula | C18H23NO3 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.17 |
| IUPAC Name | 1-[4-(4-oxopentyl)phenyl]-3-propan-2-ylpyrrolidine-2,5-dione |
| SMILES | CC(=O)CCCc1ccc(N2C(=O)CC(C(C)C)C2=O)cc1 |
| InChI | InChI=1S/C18H23NO3/c1-12(2)16-11-17(21)19(18(16)22)15-9-7-14(8-10-15)6-4-5-13(3)20/h7-10,12,16H,4-6,11H2,1-3H3 |
| InChIKey | VKCKVWAWRNJENH-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|