C22H31NO4S — CID 139404960
tert-butyl 4-[4-(3-tert-butylsulfanyl-2,5-dioxopyrrolidin-1-yl)phenyl]butanoate (PubChem CID 139404960) has the molecular formula C22H31NO4S and a molecular weight of 405.56 g/mol. Its IUPAC name is tert-butyl 4-[4-(3-tert-butylsulfanyl-2,5-dioxopyrrolidin-1-yl)phenyl]butanoate.
| Compound Name | tert-butyl 4-[4-(3-tert-butylsulfanyl-2,5-dioxopyrrolidin-1-yl)phenyl]butanoate |
|---|---|
| PubChem CID | 139404960 |
| Molecular Formula | C22H31NO4S |
| Molecular Weight | 405.56 g/mol |
| Exact Mass | 405.20 |
| IUPAC Name | tert-butyl 4-[4-(3-tert-butylsulfanyl-2,5-dioxopyrrolidin-1-yl)phenyl]butanoate |
| SMILES | CC(C)(C)OC(=O)CCCc1ccc(N2C(=O)CC(SC(C)(C)C)C2=O)cc1 |
| InChI | InChI=1S/C22H31NO4S/c1-21(2,3)27-19(25)9-7-8-15-10-12-16(13-11-15)23-18(24)14-17(20(23)26)28-22(4,5)6/h10-13,17H,7-9,14H2,1-6H3 |
| InChIKey | FBDBATGKVLXKAF-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.56 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|