C22H33BNO2S — CID 174135081
CID 174135081 (PubChem CID 174135081) has the molecular formula C22H33BNO2S and a molecular weight of 386.39 g/mol.
| Compound Name | CID 174135081 |
|---|---|
| PubChem CID | 174135081 |
| Molecular Formula | C22H33BNO2S |
| Molecular Weight | 386.39 g/mol |
| Exact Mass | 386.23 |
| IUPAC Name | — |
| SMILES | C[B]C(C)(C)CC(C)(C)c1ccc(N2C(=O)CC(SC(C)(C)C)C2=O)cc1 |
| InChI | InChI=1S/C22H33BNO2S/c1-20(2,3)27-17-13-18(25)24(19(17)26)16-11-9-15(10-12-16)21(4,5)14-22(6,7)23-8/h9-12,17H,13-14H2,1-8H3 |
| InChIKey | LSHCUVSBHPVZSJ-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.39 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|