C24H35NO3 — CID 130319944
4-[4-(3-hexan-3-yl-2,5-dioxopyrrolidin-1-yl)phenyl]-2,2,4-trimethylpentanal (PubChem CID 130319944) has the molecular formula C24H35NO3 and a molecular weight of 385.55 g/mol. Its IUPAC name is 4-[4-(3-hexan-3-yl-2,5-dioxopyrrolidin-1-yl)phenyl]-2,2,4-trimethylpentanal.
| Compound Name | 4-[4-(3-hexan-3-yl-2,5-dioxopyrrolidin-1-yl)phenyl]-2,2,4-trimethylpentanal |
|---|---|
| PubChem CID | 130319944 |
| Molecular Formula | C24H35NO3 |
| Molecular Weight | 385.55 g/mol |
| Exact Mass | 385.26 |
| IUPAC Name | 4-[4-(3-hexan-3-yl-2,5-dioxopyrrolidin-1-yl)phenyl]-2,2,4-trimethylpentanal |
| SMILES | CCCC(CC)C1CC(=O)N(c2ccc(C(C)(C)CC(C)(C)C=O)cc2)C1=O |
| InChI | InChI=1S/C24H35NO3/c1-7-9-17(8-2)20-14-21(27)25(22(20)28)19-12-10-18(11-13-19)24(5,6)15-23(3,4)16-26/h10-13,16-17,20H,7-9,14-15H2,1-6H3 |
| InChIKey | SODJUOOCDMDMSB-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.55 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|