C13H12ClNO3 — CID 139259717
2-[1-(4-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]propanal (PubChem CID 139259717) has the molecular formula C13H12ClNO3 and a molecular weight of 265.70 g/mol. Its IUPAC name is 2-[1-(4-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]propanal.
| Compound Name | 2-[1-(4-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]propanal |
|---|---|
| PubChem CID | 139259717 |
| Molecular Formula | C13H12ClNO3 |
| Molecular Weight | 265.70 g/mol |
| Exact Mass | 265.05 |
| IUPAC Name | 2-[1-(4-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]propanal |
| SMILES | CC(C=O)C1CC(=O)N(c2ccc(Cl)cc2)C1=O |
| InChI | InChI=1S/C13H12ClNO3/c1-8(7-16)11-6-12(17)15(13(11)18)10-4-2-9(14)3-5-10/h2-5,7-8,11H,6H2,1H3 |
| InChIKey | DHXJUWFJEDIROH-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.70 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|