C20H18ClN3O2 — CID 2806877
1-(4-chlorophenyl)-3-(2-propan-2-ylbenzimidazol-1-yl)pyrrolidine-2,5-dione (PubChem CID 2806877) has the molecular formula C20H18ClN3O2 and a molecular weight of 367.84 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-(2-propan-2-ylbenzimidazol-1-yl)pyrrolidine-2,5-dione.
| Compound Name | 1-(4-chlorophenyl)-3-(2-propan-2-ylbenzimidazol-1-yl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 2806877 |
| Molecular Formula | C20H18ClN3O2 |
| Molecular Weight | 367.84 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | 1-(4-chlorophenyl)-3-(2-propan-2-ylbenzimidazol-1-yl)pyrrolidine-2,5-dione |
| SMILES | CC(C)c1nc2ccccc2n1C1CC(=O)N(c2ccc(Cl)cc2)C1=O |
| InChI | InChI=1S/C20H18ClN3O2/c1-12(2)19-22-15-5-3-4-6-16(15)24(19)17-11-18(25)23(20(17)26)14-9-7-13(21)8-10-14/h3-10,12,17H,11H2,1-2H3 |
| InChIKey | GNOXZPIOOVCXCL-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.84 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|